C18H12F4N2O2 — CID 2187981
(5E)-3-[(2-fluorophenyl)methyl]-5-[[3-(trifluoromethyl)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 2187981) has the molecular formula C18H12F4N2O2 and a molecular weight of 364.30 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[[3-(trifluoromethyl)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[[3-(trifluoromethyl)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2187981 |
| Molecular Formula | C18H12F4N2O2 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[[3-(trifluoromethyl)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cccc(C(F)(F)F)c2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C18H12F4N2O2/c19-14-7-2-1-5-12(14)10-24-16(25)15(23-17(24)26)9-11-4-3-6-13(8-11)18(20,21)22/h1-9H,10H2,(H,23,26)/b15-9+ |
| InChIKey | YBUGFHWHIJWZNO-OQLLNIDSSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|