C15H14ClFN2O3 — CID 100785113
ethyl 2-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-3-oxopyridazine-4-carboxylate (PubChem CID 100785113) has the molecular formula C15H14ClFN2O3 and a molecular weight of 324.74 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-3-oxopyridazine-4-carboxylate.
| Compound Name | ethyl 2-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 100785113 |
| Molecular Formula | C15H14ClFN2O3 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | ethyl 2-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-3-oxopyridazine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(C)nn(Cc2c(F)cccc2Cl)c1=O |
| InChI | InChI=1S/C15H14ClFN2O3/c1-3-22-15(21)10-7-9(2)18-19(14(10)20)8-11-12(16)5-4-6-13(11)17/h4-7H,3,8H2,1-2H3 |
| InChIKey | ALNRQULZFZWAPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |