C18H22ClFN2O3 — CID 69315121
ethyl 3-[1-[(2-chloro-6-fluorophenyl)methyl]-3-propan-2-yloxypyrazol-5-yl]propanoate (PubChem CID 69315121) has the molecular formula C18H22ClFN2O3 and a molecular weight of 368.84 g/mol. Its IUPAC name is ethyl 3-[1-[(2-chloro-6-fluorophenyl)methyl]-3-propan-2-yloxypyrazol-5-yl]propanoate.
| Compound Name | ethyl 3-[1-[(2-chloro-6-fluorophenyl)methyl]-3-propan-2-yloxypyrazol-5-yl]propanoate |
|---|---|
| PubChem CID | 69315121 |
| Molecular Formula | C18H22ClFN2O3 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | ethyl 3-[1-[(2-chloro-6-fluorophenyl)methyl]-3-propan-2-yloxypyrazol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc(OC(C)C)nn1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H22ClFN2O3/c1-4-24-18(23)9-8-13-10-17(25-12(2)3)21-22(13)11-14-15(19)6-5-7-16(14)20/h5-7,10,12H,4,8-9,11H2,1-3H3 |
| InChIKey | ISNSJLMCGWPVGM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |