C16H11NO3S — CID 10935370
2-phenacylsulfanylisoindole-1,3-dione (PubChem CID 10935370) has the molecular formula C16H11NO3S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-phenacylsulfanylisoindole-1,3-dione.
| Compound Name | 2-phenacylsulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 10935370 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-phenacylsulfanylisoindole-1,3-dione |
| SMILES | O=C(CSN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C16H11NO3S/c18-14(11-6-2-1-3-7-11)10-21-17-15(19)12-8-4-5-9-13(12)16(17)20/h1-9H,10H2 |
| InChIKey | HRWVLTRIXHFHST-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|