C11H8Cl2FNO2S — CID 139633572
2-(3,3-dichloro-3-fluoropropyl)sulfanylisoindole-1,3-dione (PubChem CID 139633572) has the molecular formula C11H8Cl2FNO2S and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-(3,3-dichloro-3-fluoropropyl)sulfanylisoindole-1,3-dione.
| Compound Name | 2-(3,3-dichloro-3-fluoropropyl)sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 139633572 |
| Molecular Formula | C11H8Cl2FNO2S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 2-(3,3-dichloro-3-fluoropropyl)sulfanylisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1SCCC(F)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2FNO2S/c12-11(13,14)5-6-18-15-9(16)7-3-1-2-4-8(7)10(15)17/h1-4H,5-6H2 |
| InChIKey | RYFHIEBBERZYHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|