C10H6Cl3NO2S — CID 139651000
2-(1,2,2-trichloroethylsulfanyl)isoindole-1,3-dione (PubChem CID 139651000) has the molecular formula C10H6Cl3NO2S and a molecular weight of 310.59 g/mol. Its IUPAC name is 2-(1,2,2-trichloroethylsulfanyl)isoindole-1,3-dione.
| Compound Name | 2-(1,2,2-trichloroethylsulfanyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139651000 |
| Molecular Formula | C10H6Cl3NO2S |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 308.92 |
| IUPAC Name | 2-(1,2,2-trichloroethylsulfanyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1SC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C10H6Cl3NO2S/c11-7(12)8(13)17-14-9(15)5-3-1-2-4-6(5)10(14)16/h1-4,7-8H |
| InChIKey | GYUJFMUOHZHWCK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|