C18H11NO3S — CID 102022116
2-(3-hydroxynaphthalen-2-yl)sulfanylisoindole-1,3-dione (PubChem CID 102022116) has the molecular formula C18H11NO3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-(3-hydroxynaphthalen-2-yl)sulfanylisoindole-1,3-dione.
| Compound Name | 2-(3-hydroxynaphthalen-2-yl)sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 102022116 |
| Molecular Formula | C18H11NO3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(3-hydroxynaphthalen-2-yl)sulfanylisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Sc1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H11NO3S/c20-15-9-11-5-1-2-6-12(11)10-16(15)23-19-17(21)13-7-3-4-8-14(13)18(19)22/h1-10,20H |
| InChIKey | UFZICXWVLVWHFO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|