C18H17NO2S — CID 142466852
2-(3-tert-butylphenyl)sulfanylisoindole-1,3-dione (PubChem CID 142466852) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)sulfanylisoindole-1,3-dione.
| Compound Name | 2-(3-tert-butylphenyl)sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 142466852 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(3-tert-butylphenyl)sulfanylisoindole-1,3-dione |
| SMILES | CC(C)(C)c1cccc(SN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H17NO2S/c1-18(2,3)12-7-6-8-13(11-12)22-19-16(20)14-9-4-5-10-15(14)17(19)21/h4-11H,1-3H3 |
| InChIKey | FHIQNXOMVBDVFA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|