C14H18N2O2S — CID 21441522
2-(dipropylamino)sulfanylisoindole-1,3-dione (PubChem CID 21441522) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(dipropylamino)sulfanylisoindole-1,3-dione.
| Compound Name | 2-(dipropylamino)sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 21441522 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(dipropylamino)sulfanylisoindole-1,3-dione |
| SMILES | CCCN(CCC)SN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H18N2O2S/c1-3-9-15(10-4-2)19-16-13(17)11-7-5-6-8-12(11)14(16)18/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | ODYOMCAQBKZHDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|