C13H10Cl3N3O2S5Zn — CID 88629174
zinc;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate;2-(trichloromethylsulfanyl)isoindole-1,3-dione (PubChem CID 88629174) has the molecular formula C13H10Cl3N3O2S5Zn and a molecular weight of 572.33 g/mol. Its IUPAC name is zinc;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate;2-(trichloromethylsulfanyl)isoindole-1,3-dione.
| Compound Name | zinc;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate;2-(trichloromethylsulfanyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 88629174 |
| Molecular Formula | C13H10Cl3N3O2S5Zn |
| Molecular Weight | 572.33 g/mol |
| Exact Mass | 568.77 |
| IUPAC Name | zinc;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate;2-(trichloromethylsulfanyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1SC(Cl)(Cl)Cl.S=C([S-])NCCNC(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C9H4Cl3NO2S.C4H8N2S4.Zn/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15;7-3(8)5-1-2-6-4(9)10;/h1-4H;1-2H2,(H2,5,7,8)(H2,6,9,10);/q;;+2/p-2 |
| InChIKey | LIVOFRHUAMSYHT-UHFFFAOYSA-L |
| XLogP | 3.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|