C4H6Cu2N2S4 — CID 87101556
bis(copper(1+));N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate (PubChem CID 87101556) has the molecular formula C4H6Cu2N2S4 and a molecular weight of 337.47 g/mol. Its IUPAC name is bis(copper(1+));N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate.
| Compound Name | bis(copper(1+));N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 87101556 |
| Molecular Formula | C4H6Cu2N2S4 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 335.80 |
| IUPAC Name | bis(copper(1+));N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
| SMILES | S=C([S-])NCCNC(=S)[S-].[Cu+].[Cu+] |
| InChI | InChI=1S/C4H8N2S4.2Cu/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);;/q;2*+1/p-2 |
| InChIKey | YTBLTBIKPGMVHH-UHFFFAOYSA-L |
| XLogP | -0.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|