C8H14N2S4Zn — CID 15651749
zinc N-[6-(sulfidocarbothioylamino)hexyl]carbamodithioate (PubChem CID 15651749) has the molecular formula C8H14N2S4Zn and a molecular weight of 331.87 g/mol. Its IUPAC name is zinc N-[6-(sulfidocarbothioylamino)hexyl]carbamodithioate.
| Compound Name | zinc N-[6-(sulfidocarbothioylamino)hexyl]carbamodithioate |
|---|---|
| PubChem CID | 15651749 |
| Molecular Formula | C8H14N2S4Zn |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | zinc N-[6-(sulfidocarbothioylamino)hexyl]carbamodithioate |
| SMILES | S=C([S-])NCCCCCCNC(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C8H16N2S4.Zn/c11-7(12)9-5-3-1-2-4-6-10-8(13)14;/h1-6H2,(H2,9,11,12)(H2,10,13,14);/q;+2/p-2 |
| InChIKey | DZZVQLRHSMKSGS-UHFFFAOYSA-L |
| XLogP | 1.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|