C3H12N4S4 — CID 87867679
diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate (PubChem CID 87867679) has the molecular formula C3H12N4S4 and a molecular weight of 232.43 g/mol. Its IUPAC name is diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate.
| Compound Name | diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate |
|---|---|
| PubChem CID | 87867679 |
| Molecular Formula | C3H12N4S4 |
| Molecular Weight | 232.43 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate |
| SMILES | S=C([S-])NCNC(=S)[S-].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H6N2S4.2H3N/c6-2(7)4-1-5-3(8)9;;/h1H2,(H2,4,6,7)(H2,5,8,9);2*1H3 |
| InChIKey | TWSQJUOOSLIHHC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|