About diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate
diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate (PubChem CID 87867679) has the molecular formula C3H12N4S4
and a molecular weight of 232.40 g/mol. Its IUPAC name is diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate.
Molecular Properties
| Compound Name | diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate |
| PubChem CID | 87867679 |
| Molecular Formula | C3H12N4S4 |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate |
| SMILES | C(NC(=S)[S-])NC(=S)[S-].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H6N2S4.2H3N/c6-2(7)4-1-5-3(8)9;;/h1H2,(H2,4,6,7)(H2,5,8,9);2*1H3 |
| InChIKey | TWSQJUOOSLIHHC-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 92.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 98 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate?
The IUPAC name of diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate (CID 87867679) is diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate.
What is the SMILES notation for diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate?
The canonical SMILES for diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate is C(NC(=S)[S-])NC(=S)[S-].[NH4+].[NH4+].
What is the InChIKey of diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate?
The InChIKey is TWSQJUOOSLIHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S4.2H3N/c6-2(7)4-1-5-3(8)9;;/h1H2,(H2,4,6,7)(H2,5,8,9);2*1H3.
What are the key properties of diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate?
diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate has a molecular weight of 232.40 g/mol, XLogP of not available, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;N-[(sulfidocarbothioylamino)methyl]carbamodithioate is sourced from PubChem (CID 87867679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).