C5H8N2Na2OS4 — CID 173431312
disodium;formaldehyde;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate (PubChem CID 173431312) has the molecular formula C5H8N2Na2OS4 and a molecular weight of 286.38 g/mol. Its IUPAC name is disodium;formaldehyde;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate.
| Compound Name | disodium;formaldehyde;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 173431312 |
| Molecular Formula | C5H8N2Na2OS4 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | disodium;formaldehyde;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
| SMILES | C=O.S=C([S-])NCCNC(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C4H8N2S4.CH2O.2Na/c7-3(8)5-1-2-6-4(9)10;1-2;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);1H2;;/q;;2*+1/p-2 |
| InChIKey | BKGSXGYVFNSHCZ-UHFFFAOYSA-L |
| XLogP | -6.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|