C5H8N2S4Zn — CID 12898683
zinc N-[3-(sulfidocarbothioylamino)propyl]carbamodithioate (PubChem CID 12898683) has the molecular formula C5H8N2S4Zn and a molecular weight of 289.79 g/mol. Its IUPAC name is zinc N-[3-(sulfidocarbothioylamino)propyl]carbamodithioate.
| Compound Name | zinc N-[3-(sulfidocarbothioylamino)propyl]carbamodithioate |
|---|---|
| PubChem CID | 12898683 |
| Molecular Formula | C5H8N2S4Zn |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | zinc N-[3-(sulfidocarbothioylamino)propyl]carbamodithioate |
| SMILES | S=C([S-])NCCCNC(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C5H10N2S4.Zn/c8-4(9)6-2-1-3-7-5(10)11;/h1-3H2,(H2,6,8,9)(H2,7,10,11);/q;+2/p-2 |
| InChIKey | OKXSZVMQSGQANJ-UHFFFAOYSA-L |
| XLogP | 0.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|