C9H22N5NaS2 — CID 90475849
sodium N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]carbamodithioate (PubChem CID 90475849) has the molecular formula C9H22N5NaS2 and a molecular weight of 287.43 g/mol. Its IUPAC name is sodium N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]carbamodithioate.
| Compound Name | sodium N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]carbamodithioate |
|---|---|
| PubChem CID | 90475849 |
| Molecular Formula | C9H22N5NaS2 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | sodium N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]carbamodithioate |
| SMILES | NCCNCCNCCNCCNC(=S)[S-].[Na+] |
| InChI | InChI=1S/C9H23N5S2.Na/c10-1-2-11-3-4-12-5-6-13-7-8-14-9(15)16;/h11-13H,1-8,10H2,(H2,14,15,16);/q;+1/p-1 |
| InChIKey | QYNKWNNYIJEJQS-UHFFFAOYSA-M |
| XLogP | -4.86 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|