C8H16N4Na2S4 — CID 172718417
disodium;N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-N-sulfidocarbothioylcarbamodithioate (PubChem CID 172718417) has the molecular formula C8H16N4Na2S4 and a molecular weight of 342.49 g/mol. Its IUPAC name is disodium;N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-N-sulfidocarbothioylcarbamodithioate.
| Compound Name | disodium;N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-N-sulfidocarbothioylcarbamodithioate |
|---|---|
| PubChem CID | 172718417 |
| Molecular Formula | C8H16N4Na2S4 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | disodium;N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-N-sulfidocarbothioylcarbamodithioate |
| SMILES | NCCNCCNCCN(C(=S)[S-])C(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C8H18N4S4.2Na/c9-1-2-10-3-4-11-5-6-12(7(13)14)8(15)16;;/h10-11H,1-6,9H2,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | GEECHSQYGRARSD-UHFFFAOYSA-L |
| XLogP | -6.90 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | -6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|