C14H38N8S — CID 160913498
N'-(2-aminoethyl)ethane-1,2-diamine;N,N-bis[2-(2-aminoethylamino)ethyl]ethanethioamide (PubChem CID 160913498) has the molecular formula C14H38N8S and a molecular weight of 350.58 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;N,N-bis[2-(2-aminoethylamino)ethyl]ethanethioamide.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;N,N-bis[2-(2-aminoethylamino)ethyl]ethanethioamide |
|---|---|
| PubChem CID | 160913498 |
| Molecular Formula | C14H38N8S |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;N,N-bis[2-(2-aminoethylamino)ethyl]ethanethioamide |
| SMILES | CC(=S)N(CCNCCN)CCNCCN.NCCNCCN |
| InChI | InChI=1S/C10H25N5S.C4H13N3/c1-10(16)15(8-6-13-4-2-11)9-7-14-5-3-12;5-1-3-7-4-2-6/h13-14H,2-9,11-12H2,1H3;7H,1-6H2 |
| InChIKey | SRCGRZVDXDVXFJ-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|