C10H25N3O2 — CID 23036601
1-[2-(2-aminoethylamino)ethyl-(1-hydroxypropyl)amino]propan-1-ol (PubChem CID 23036601) has the molecular formula C10H25N3O2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-[2-(2-aminoethylamino)ethyl-(1-hydroxypropyl)amino]propan-1-ol.
| Compound Name | 1-[2-(2-aminoethylamino)ethyl-(1-hydroxypropyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 23036601 |
| Molecular Formula | C10H25N3O2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | 1-[2-(2-aminoethylamino)ethyl-(1-hydroxypropyl)amino]propan-1-ol |
| SMILES | CCC(O)N(CCNCCN)C(O)CC |
| InChI | InChI=1S/C10H25N3O2/c1-3-9(14)13(10(15)4-2)8-7-12-6-5-11/h9-10,12,14-15H,3-8,11H2,1-2H3 |
| InChIKey | JAXCQANOVZSROI-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|