C8H23N5O — CID 87930243
1-[2-(2-aminoethylamino)ethyl-(1,2-diaminoethyl)amino]ethanol (PubChem CID 87930243) has the molecular formula C8H23N5O and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-[2-(2-aminoethylamino)ethyl-(1,2-diaminoethyl)amino]ethanol.
| Compound Name | 1-[2-(2-aminoethylamino)ethyl-(1,2-diaminoethyl)amino]ethanol |
|---|---|
| PubChem CID | 87930243 |
| Molecular Formula | C8H23N5O |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.19 |
| IUPAC Name | 1-[2-(2-aminoethylamino)ethyl-(1,2-diaminoethyl)amino]ethanol |
| SMILES | CC(O)N(CCNCCN)C(N)CN |
| InChI | InChI=1S/C8H23N5O/c1-7(14)13(8(11)6-10)5-4-12-3-2-9/h7-8,12,14H,2-6,9-11H2,1H3 |
| InChIKey | BMVVWROKMSEOPZ-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|