C10H25N3O4 — CID 19091199
acetic acid;1-[2-(2-aminoethylamino)ethyl-(1-hydroxyethyl)amino]ethanol (PubChem CID 19091199) has the molecular formula C10H25N3O4 and a molecular weight of 251.33 g/mol. Its IUPAC name is acetic acid;1-[2-(2-aminoethylamino)ethyl-(1-hydroxyethyl)amino]ethanol.
| Compound Name | acetic acid;1-[2-(2-aminoethylamino)ethyl-(1-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 19091199 |
| Molecular Formula | C10H25N3O4 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | acetic acid;1-[2-(2-aminoethylamino)ethyl-(1-hydroxyethyl)amino]ethanol |
| SMILES | CC(=O)O.CC(O)N(CCNCCN)C(C)O |
| InChI | InChI=1S/C8H21N3O2.C2H4O2/c1-7(12)11(8(2)13)6-5-10-4-3-9;1-2(3)4/h7-8,10,12-13H,3-6,9H2,1-2H3;1H3,(H,3,4) |
| InChIKey | WSAVROAGZVCBCJ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|