C11H30N4O2 — CID 18704362
2-(2-aminoethylamino)ethanol;1,3-bis(dimethylamino)propan-2-ol (PubChem CID 18704362) has the molecular formula C11H30N4O2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethanol;1,3-bis(dimethylamino)propan-2-ol.
| Compound Name | 2-(2-aminoethylamino)ethanol;1,3-bis(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 18704362 |
| Molecular Formula | C11H30N4O2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 2-(2-aminoethylamino)ethanol;1,3-bis(dimethylamino)propan-2-ol |
| SMILES | CN(C)CC(O)CN(C)C.NCCNCCO |
| InChI | InChI=1S/C7H18N2O.C4H12N2O/c1-8(2)5-7(10)6-9(3)4;5-1-2-6-3-4-7/h7,10H,5-6H2,1-4H3;6-7H,1-5H2 |
| InChIKey | CKHRUXIDUOUXBN-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|