C8H18N4S4 — CID 172718418
2-[2-(2-aminoethylamino)ethylamino]ethyl-dithiocarboxycarbamodithioic acid (PubChem CID 172718418) has the molecular formula C8H18N4S4 and a molecular weight of 298.53 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)ethylamino]ethyl-dithiocarboxycarbamodithioic acid.
| Compound Name | 2-[2-(2-aminoethylamino)ethylamino]ethyl-dithiocarboxycarbamodithioic acid |
|---|---|
| PubChem CID | 172718418 |
| Molecular Formula | C8H18N4S4 |
| Molecular Weight | 298.53 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-[2-(2-aminoethylamino)ethylamino]ethyl-dithiocarboxycarbamodithioic acid |
| SMILES | NCCNCCNCCN(C(=S)S)C(=S)S |
| InChI | InChI=1S/C8H18N4S4/c9-1-2-10-3-4-11-5-6-12(7(13)14)8(15)16/h10-11H,1-6,9H2,(H,13,14)(H,15,16) |
| InChIKey | OLDWQYGPRANWAY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.53 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|