About magnesium dicarbamodithioate
magnesium dicarbamodithioate (PubChem CID 23080754) has the molecular formula C2H4MgN2S4
and a molecular weight of 208.64 g/mol. Its IUPAC name is magnesium dicarbamodithioate.
Molecular Properties
| Compound Name | magnesium dicarbamodithioate |
| PubChem CID | 23080754 |
| Molecular Formula | C2H4MgN2S4 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 207.91 |
| IUPAC Name | magnesium dicarbamodithioate |
| SMILES | NC(=S)[S-].NC(=S)[S-].[Mg+2] |
| InChI | InChI=1S/2CH3NS2.Mg/c2*2-1(3)4;/h2*(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | KITLTFRGASVPBY-UHFFFAOYSA-L |
| XLogP | -0.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium dicarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium dicarbamodithioate?
The IUPAC name of magnesium dicarbamodithioate (CID 23080754) is magnesium dicarbamodithioate.
What is the SMILES notation for magnesium dicarbamodithioate?
The canonical SMILES for magnesium dicarbamodithioate is NC(=S)[S-].NC(=S)[S-].[Mg+2].
What is the InChIKey of magnesium dicarbamodithioate?
The InChIKey is KITLTFRGASVPBY-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH3NS2.Mg/c2*2-1(3)4;/h2*(H3,2,3,4);/q;;+2/p-2.
What are the key properties of magnesium dicarbamodithioate?
magnesium dicarbamodithioate has a molecular weight of 208.64 g/mol, XLogP of -0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium dicarbamodithioate is sourced from PubChem (CID 23080754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).