About molybdenum;zinc;carbamodithioate
molybdenum;zinc;carbamodithioate (PubChem CID 174974213) has the molecular formula CH2MoNS2Zn-
and a molecular weight of 253.50 g/mol. Its IUPAC name is molybdenum;zinc;carbamodithioate.
Molecular Properties
| Compound Name | molybdenum;zinc;carbamodithioate |
| PubChem CID | 174974213 |
| Molecular Formula | CH2MoNS2Zn- |
| Molecular Weight | 253.50 g/mol |
| Exact Mass | 253.80 |
| IUPAC Name | molybdenum;zinc;carbamodithioate |
| SMILES | NC(=S)[S-].[Mo].[Zn] |
| InChI | InChI=1S/CH3NS2.Mo.Zn/c2-1(3)4;;/h(H3,2,3,4);;/p-1 |
| InChIKey | PBPQBHLIKCWRDB-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.50 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze molybdenum;zinc;carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum;zinc;carbamodithioate?
The IUPAC name of molybdenum;zinc;carbamodithioate (CID 174974213) is molybdenum;zinc;carbamodithioate.
What is the SMILES notation for molybdenum;zinc;carbamodithioate?
The canonical SMILES for molybdenum;zinc;carbamodithioate is NC(=S)[S-].[Mo].[Zn].
What is the InChIKey of molybdenum;zinc;carbamodithioate?
The InChIKey is PBPQBHLIKCWRDB-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3NS2.Mo.Zn/c2-1(3)4;;/h(H3,2,3,4);;/p-1.
What are the key properties of molybdenum;zinc;carbamodithioate?
molybdenum;zinc;carbamodithioate has a molecular weight of 253.50 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum;zinc;carbamodithioate is sourced from PubChem (CID 174974213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).