About disodium;ethanebis(dithioate)
disodium;ethanebis(dithioate) (PubChem CID 87697624) has the molecular formula C2Na2S4
and a molecular weight of 198.27 g/mol. Its IUPAC name is disodium;ethanebis(dithioate).
Molecular Properties
| Compound Name | disodium;ethanebis(dithioate) |
| PubChem CID | 87697624 |
| Molecular Formula | C2Na2S4 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.87 |
| IUPAC Name | disodium;ethanebis(dithioate) |
| SMILES | S=C([S-])C(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C2H2S4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| InChIKey | DXFYKTLQCYYDBM-UHFFFAOYSA-L |
| XLogP | -5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;ethanebis(dithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;ethanebis(dithioate)?
The IUPAC name of disodium;ethanebis(dithioate) (CID 87697624) is disodium;ethanebis(dithioate).
What is the SMILES notation for disodium;ethanebis(dithioate)?
The canonical SMILES for disodium;ethanebis(dithioate) is S=C([S-])C(=S)[S-].[Na+].[Na+].
What is the InChIKey of disodium;ethanebis(dithioate)?
The InChIKey is DXFYKTLQCYYDBM-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2S4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2.
What are the key properties of disodium;ethanebis(dithioate)?
disodium;ethanebis(dithioate) has a molecular weight of 198.27 g/mol, XLogP of -5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;ethanebis(dithioate) is sourced from PubChem (CID 87697624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).