About gold(1+) carbamodithioate
gold(1+) carbamodithioate (PubChem CID 118378800) has the molecular formula CH2AuNS2
and a molecular weight of 289.14 g/mol. Its IUPAC name is gold(1+) carbamodithioate.
Molecular Properties
| Compound Name | gold(1+) carbamodithioate |
| PubChem CID | 118378800 |
| Molecular Formula | CH2AuNS2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | gold(1+) carbamodithioate |
| SMILES | NC(=S)[S-].[Au+] |
| InChI | InChI=1S/CH3NS2.Au/c2-1(3)4;/h(H3,2,3,4);/q;+1/p-1 |
| InChIKey | SMBVKLRCXBEKIS-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze gold(1+) carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+) carbamodithioate?
The IUPAC name of gold(1+) carbamodithioate (CID 118378800) is gold(1+) carbamodithioate.
What is the SMILES notation for gold(1+) carbamodithioate?
The canonical SMILES for gold(1+) carbamodithioate is NC(=S)[S-].[Au+].
What is the InChIKey of gold(1+) carbamodithioate?
The InChIKey is SMBVKLRCXBEKIS-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3NS2.Au/c2-1(3)4;/h(H3,2,3,4);/q;+1/p-1.
What are the key properties of gold(1+) carbamodithioate?
gold(1+) carbamodithioate has a molecular weight of 289.14 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+) carbamodithioate is sourced from PubChem (CID 118378800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).