About carbanide;ethanebis(dithioate);bis(gold(3+))
carbanide;ethanebis(dithioate);bis(gold(3+)) (PubChem CID 135083321) has the molecular formula C6H12Au2S4
and a molecular weight of 606.36 g/mol. Its IUPAC name is carbanide;ethanebis(dithioate);bis(gold(3+)).
Molecular Properties
| Compound Name | carbanide;ethanebis(dithioate);bis(gold(3+)) |
| PubChem CID | 135083321 |
| Molecular Formula | C6H12Au2S4 |
| Molecular Weight | 606.36 g/mol |
| Exact Mass | 605.92 |
| IUPAC Name | carbanide;ethanebis(dithioate);bis(gold(3+)) |
| SMILES | S=C([S-])C(=S)[S-].[Au+3].[Au+3].[CH3-].[CH3-].[CH3-].[CH3-] |
| InChI | InChI=1S/C2H2S4.4CH3.2Au/c3-1(4)2(5)6;;;;;;/h(H,3,4)(H,5,6);4*1H3;;/q;4*-1;2*+3/p-2 |
| InChIKey | WINHSIVQQKOQIK-UHFFFAOYSA-L |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 606.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;ethanebis(dithioate);bis(gold(3+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;ethanebis(dithioate);bis(gold(3+))?
The IUPAC name of carbanide;ethanebis(dithioate);bis(gold(3+)) (CID 135083321) is carbanide;ethanebis(dithioate);bis(gold(3+)).
What is the SMILES notation for carbanide;ethanebis(dithioate);bis(gold(3+))?
The canonical SMILES for carbanide;ethanebis(dithioate);bis(gold(3+)) is S=C([S-])C(=S)[S-].[Au+3].[Au+3].[CH3-].[CH3-].[CH3-].[CH3-].
What is the InChIKey of carbanide;ethanebis(dithioate);bis(gold(3+))?
The InChIKey is WINHSIVQQKOQIK-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2S4.4CH3.2Au/c3-1(4)2(5)6;;;;;;/h(H,3,4)(H,5,6);4*1H3;;/q;4*-1;2*+3/p-2.
What are the key properties of carbanide;ethanebis(dithioate);bis(gold(3+))?
carbanide;ethanebis(dithioate);bis(gold(3+)) has a molecular weight of 606.36 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;ethanebis(dithioate);bis(gold(3+)) is sourced from PubChem (CID 135083321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).