C16H32N2O6S — CID 160567050
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;2-methylpropyl formate (PubChem CID 160567050) has the molecular formula C16H32N2O6S and a molecular weight of 380.51 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;2-methylpropyl formate.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;2-methylpropyl formate |
|---|---|
| PubChem CID | 160567050 |
| Molecular Formula | C16H32N2O6S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;2-methylpropyl formate |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS.CC(C)COC=O |
| InChI | InChI=1S/C11H22N2O4S.C5H10O2/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18;1-5(2)3-7-4-6/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17);4-5H,3H2,1-2H3/t9-;/m0./s1 |
| InChIKey | RABFGMJFRABFPI-FVGYRXGTSA-N |
| XLogP | -0.27 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|