C32H59N3O5 — CID 67795636
(Z)-N-[[1-[3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoyl]pyrrolidin-2-yl]methyl]octadec-9-enamide (PubChem CID 67795636) has the molecular formula C32H59N3O5 and a molecular weight of 565.84 g/mol. Its IUPAC name is (Z)-N-[[1-[3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoyl]pyrrolidin-2-yl]methyl]octadec-9-enamide.
| Compound Name | (Z)-N-[[1-[3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoyl]pyrrolidin-2-yl]methyl]octadec-9-enamide |
|---|---|
| PubChem CID | 67795636 |
| Molecular Formula | C32H59N3O5 |
| Molecular Weight | 565.84 g/mol |
| Exact Mass | 565.45 |
| IUPAC Name | (Z)-N-[[1-[3-[[(2S)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoyl]pyrrolidin-2-yl]methyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC1CCCN1C(=O)CCNC(=O)[C@@H](O)C(C)(C)CO |
| InChI | InChI=1S/C32H59N3O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-28(37)34-25-27-20-19-24-35(27)29(38)22-23-33-31(40)30(39)32(2,3)26-36/h11-12,27,30,36,39H,4-10,13-26H2,1-3H3,(H,33,40)(H,34,37)/b12-11-/t27?,30-/m1/s1 |
| InChIKey | PUYMMMAWAYWMGW-NYONQFRGSA-N |
| XLogP | 5.02 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|