C17H32N2O4 — CID 25169721
(2R)-N-[4-(cyclohexylmethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 25169721) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2R)-N-[4-(cyclohexylmethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[4-(cyclohexylmethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25169721 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (2R)-N-[4-(cyclohexylmethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C17H32N2O4/c1-17(2,12-20)15(22)16(23)18-10-6-9-14(21)19-11-13-7-4-3-5-8-13/h13,15,20,22H,3-12H2,1-2H3,(H,18,23)(H,19,21)/t15-/m0/s1 |
| InChIKey | VUIPWPQBEIVJLS-HNNXBMFYSA-N |
| XLogP | 0.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|