C17H23FN2O5 — CID 118353377
N-[4-[(4-fluorophenyl)methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 118353377) has the molecular formula C17H23FN2O5 and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[4-[(4-fluorophenyl)methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118353377 |
| Molecular Formula | C17H23FN2O5 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[4-[(4-fluorophenyl)methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2O5/c1-17(2,10-21)14(23)16(25)19-8-7-13(22)15(24)20-9-11-3-5-12(18)6-4-11/h3-6,14,21,23H,7-10H2,1-2H3,(H,19,25)(H,20,24) |
| InChIKey | DIWDKAZXBSEWBV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|