C22H27NO5 — CID 148588467
(2R)-2,4-dihydroxy-3,3-dimethyl-N-(6-naphthalen-1-yl-3,4-dioxohexyl)butanamide (PubChem CID 148588467) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-(6-naphthalen-1-yl-3,4-dioxohexyl)butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-(6-naphthalen-1-yl-3,4-dioxohexyl)butanamide |
|---|---|
| PubChem CID | 148588467 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-(6-naphthalen-1-yl-3,4-dioxohexyl)butanamide |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)C(=O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C22H27NO5/c1-22(2,14-24)20(27)21(28)23-13-12-19(26)18(25)11-10-16-8-5-7-15-6-3-4-9-17(15)16/h3-9,20,24,27H,10-14H2,1-2H3,(H,23,28)/t20-/m0/s1 |
| InChIKey | NAEBQKDDFFYCBC-FQEVSTJZSA-N |
| XLogP | 1.80 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|