C17H31N3O7S — CID 123543133
2,4-dihydroxy-3,3-dimethyl-N-[4-[(1-methylsulfonylpiperidin-4-yl)methylamino]-3,4-dioxobutyl]butanamide (PubChem CID 123543133) has the molecular formula C17H31N3O7S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2,4-dihydroxy-3,3-dimethyl-N-[4-[(1-methylsulfonylpiperidin-4-yl)methylamino]-3,4-dioxobutyl]butanamide.
| Compound Name | 2,4-dihydroxy-3,3-dimethyl-N-[4-[(1-methylsulfonylpiperidin-4-yl)methylamino]-3,4-dioxobutyl]butanamide |
|---|---|
| PubChem CID | 123543133 |
| Molecular Formula | C17H31N3O7S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2,4-dihydroxy-3,3-dimethyl-N-[4-[(1-methylsulfonylpiperidin-4-yl)methylamino]-3,4-dioxobutyl]butanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)C(=O)NCC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H31N3O7S/c1-17(2,11-21)14(23)16(25)18-7-4-13(22)15(24)19-10-12-5-8-20(9-6-12)28(3,26)27/h12,14,21,23H,4-11H2,1-3H3,(H,18,25)(H,19,24) |
| InChIKey | GABFEGJABIDBTQ-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|