C15H16N6OS2 — CID 15050494
2-(diaminomethylideneamino)-N-(6-propyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 15050494) has the molecular formula C15H16N6OS2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(6-propyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(diaminomethylideneamino)-N-(6-propyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 15050494 |
| Molecular Formula | C15H16N6OS2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(6-propyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCc1ccc2nc(NC(=O)c3csc(N=C(N)N)n3)sc2c1 |
| InChI | InChI=1S/C15H16N6OS2/c1-2-3-8-4-5-9-11(6-8)24-15(18-9)20-12(22)10-7-23-14(19-10)21-13(16)17/h4-7H,2-3H2,1H3,(H,18,20,22)(H4,16,17,19,21) |
| InChIKey | PBFDSSVMWADKAU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|