C14H14N6O2S2 — CID 15050501
2-(diaminomethylideneamino)-N-(5-ethoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 15050501) has the molecular formula C14H14N6O2S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(5-ethoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(diaminomethylideneamino)-N-(5-ethoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 15050501 |
| Molecular Formula | C14H14N6O2S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(5-ethoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc2sc(NC(=O)c3csc(N=C(N)N)n3)nc2c1 |
| InChI | InChI=1S/C14H14N6O2S2/c1-2-22-7-3-4-10-8(5-7)17-14(24-10)19-11(21)9-6-23-13(18-9)20-12(15)16/h3-6H,2H2,1H3,(H,17,19,21)(H4,15,16,18,20) |
| InChIKey | NIEVYOSREZTNHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|