C34H36N6O4S — CID 45271552
2-(3-aminopropoxy)-N-[[4-[3-(diaminomethylideneamino)propoxy]phenyl]methyl]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 45271552) has the molecular formula C34H36N6O4S and a molecular weight of 624.77 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-N-[[4-[3-(diaminomethylideneamino)propoxy]phenyl]methyl]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-(3-aminopropoxy)-N-[[4-[3-(diaminomethylideneamino)propoxy]phenyl]methyl]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 45271552 |
| Molecular Formula | C34H36N6O4S |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-(3-aminopropoxy)-N-[[4-[3-(diaminomethylideneamino)propoxy]phenyl]methyl]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | NCCCOc1ccccc1C(=O)N(Cc1ccc(OCCCN=C(N)N)cc1)c1nc2ccc(Oc3ccccc3)cc2s1 |
| InChI | InChI=1S/C34H36N6O4S/c35-18-6-20-43-30-11-5-4-10-28(30)32(41)40(23-24-12-14-25(15-13-24)42-21-7-19-38-33(36)37)34-39-29-17-16-27(22-31(29)45-34)44-26-8-2-1-3-9-26/h1-5,8-17,22H,6-7,18-21,23,35H2,(H4,36,37,38) |
| InChIKey | AEYRJQSLOWITAB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|