C27H28N2O4S — CID 2449845
N-benzyl-4-(4-ethoxyphenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide (PubChem CID 2449845) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-benzyl-4-(4-ethoxyphenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | N-benzyl-4-(4-ethoxyphenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2449845 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-benzyl-4-(4-ethoxyphenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCOc1ccc(OCCCC(=O)N(Cc2ccccc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-3-32-21-11-13-22(14-12-21)33-17-7-10-26(30)29(19-20-8-5-4-6-9-20)27-28-24-16-15-23(31-2)18-25(24)34-27/h4-6,8-9,11-16,18H,3,7,10,17,19H2,1-2H3 |
| InChIKey | KIACBYYCWKITLG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|