C21H22N2O2S — CID 52866242
N-benzyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)pent-4-enamide (PubChem CID 52866242) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-benzyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)pent-4-enamide.
| Compound Name | N-benzyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)pent-4-enamide |
|---|---|
| PubChem CID | 52866242 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-benzyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)pent-4-enamide |
| SMILES | C=CCCC(=O)N(Cc1ccccc1)c1nc2ccc(OCC)cc2s1 |
| InChI | InChI=1S/C21H22N2O2S/c1-3-5-11-20(24)23(15-16-9-7-6-8-10-16)21-22-18-13-12-17(25-4-2)14-19(18)26-21/h3,6-10,12-14H,1,4-5,11,15H2,2H3 |
| InChIKey | LCSUIIBRLZTTOU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|