C12H14N4O2S — CID 19114331
2-butoxy-N-(thiatriazol-5-yl)benzamide (PubChem CID 19114331) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-butoxy-N-(thiatriazol-5-yl)benzamide.
| Compound Name | 2-butoxy-N-(thiatriazol-5-yl)benzamide |
|---|---|
| PubChem CID | 19114331 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-butoxy-N-(thiatriazol-5-yl)benzamide |
| SMILES | CCCCOc1ccccc1C(=O)Nc1nnns1 |
| InChI | InChI=1S/C12H14N4O2S/c1-2-3-8-18-10-7-5-4-6-9(10)11(17)13-12-14-15-16-19-12/h4-7H,2-3,8H2,1H3,(H,13,14,16,17) |
| InChIKey | LSMOJYLRAGXBMQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|