C19H18ClFN4O4S2 — CID 25262934
2-chloro-N-[[6-[2-(2-fluoroethylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide (PubChem CID 25262934) has the molecular formula C19H18ClFN4O4S2 and a molecular weight of 484.96 g/mol. Its IUPAC name is 2-chloro-N-[[6-[2-(2-fluoroethylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-[2-(2-fluoroethylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 25262934 |
| Molecular Formula | C19H18ClFN4O4S2 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-chloro-N-[[6-[2-(2-fluoroethylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1nc2ccc(S(=O)(=O)CCNCCF)cc2s1 |
| InChI | InChI=1S/C19H18ClFN4O4S2/c20-14-4-2-1-3-13(14)17(26)24-18(27)25-19-23-15-6-5-12(11-16(15)30-19)31(28,29)10-9-22-8-7-21/h1-6,11,22H,7-10H2,(H2,23,24,25,26,27) |
| InChIKey | BBANOYKICOXKNI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|