C23H25ClN4O5S2 — CID 175265652
2-chloro-N-[[6-[3-imino-4-(methoxymethyl)hexyl]sulfonyl-1,3-benzothiazol-2-yl]carbamoyl]benzamide (PubChem CID 175265652) has the molecular formula C23H25ClN4O5S2 and a molecular weight of 537.06 g/mol. Its IUPAC name is 2-chloro-N-[[6-[3-imino-4-(methoxymethyl)hexyl]sulfonyl-1,3-benzothiazol-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-[3-imino-4-(methoxymethyl)hexyl]sulfonyl-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 175265652 |
| Molecular Formula | C23H25ClN4O5S2 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-chloro-N-[[6-[3-imino-4-(methoxymethyl)hexyl]sulfonyl-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
| SMILES | [H]/N=C(/CCS(=O)(=O)c1ccc2nc(NC(=O)NC(=O)c3ccccc3Cl)sc2c1)C(CC)COC |
| InChI | InChI=1S/C23H25ClN4O5S2/c1-3-14(13-33-2)18(25)10-11-35(31,32)15-8-9-19-20(12-15)34-23(26-19)28-22(30)27-21(29)16-6-4-5-7-17(16)24/h4-9,12,14,25H,3,10-11,13H2,1-2H3,(H2,26,27,28,29,30)/b25-18- |
| InChIKey | NNSNVENYKRFNLL-BWAHOGKJSA-N |
| XLogP | 4.77 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|