C21H23ClN4O4S2 — CID 57422655
2-chloro-N-[[6-[2-(2-methylpropylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide (PubChem CID 57422655) has the molecular formula C21H23ClN4O4S2 and a molecular weight of 495.03 g/mol. Its IUPAC name is 2-chloro-N-[[6-[2-(2-methylpropylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-[2-(2-methylpropylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 57422655 |
| Molecular Formula | C21H23ClN4O4S2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-chloro-N-[[6-[2-(2-methylpropylamino)ethylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
| SMILES | CC(C)CNCCS(=O)(=O)c1ccc2nc(NC(=O)NC(=O)c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C21H23ClN4O4S2/c1-13(2)12-23-9-10-32(29,30)14-7-8-17-18(11-14)31-21(24-17)26-20(28)25-19(27)15-5-3-4-6-16(15)22/h3-8,11,13,23H,9-10,12H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | PDKDVKCEJFLMBJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|