C14H12N4O3S2 — CID 734500
N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide (PubChem CID 734500) has the molecular formula C14H12N4O3S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 734500 |
| Molecular Formula | C14H12N4O3S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc2nc(NC(=O)c3ccncc3)sc2c1 |
| InChI | InChI=1S/C14H12N4O3S2/c1-15-23(20,21)10-2-3-11-12(8-10)22-14(17-11)18-13(19)9-4-6-16-7-5-9/h2-8,15H,1H3,(H,17,18,19) |
| InChIKey | BXAZPVGCCBBQRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |