C15H14N4O3S2 — CID 1188159
N-[6-(ethylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide (PubChem CID 1188159) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[6-(ethylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-(ethylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1188159 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[6-(ethylsulfamoyl)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
| SMILES | CCNS(=O)(=O)c1ccc2nc(NC(=O)c3cccnc3)sc2c1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-2-17-24(21,22)11-5-6-12-13(8-11)23-15(18-12)19-14(20)10-4-3-7-16-9-10/h3-9,17H,2H2,1H3,(H,18,19,20) |
| InChIKey | ZPUVYTZHDDXFFX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |