C23H21N3O3S2 — CID 3339715
N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]-3,3-diphenylpropanamide (PubChem CID 3339715) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 3339715 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]-3,3-diphenylpropanamide |
| SMILES | CNS(=O)(=O)c1ccc2nc(NC(=O)CC(c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-24-31(28,29)18-12-13-20-21(14-18)30-23(25-20)26-22(27)15-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,19,24H,15H2,1H3,(H,25,26,27) |
| InChIKey | GRMXJUMMSUHQFF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |