C17H16N2O3S3 — CID 2349260
N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-phenylsulfanylpropanamide (PubChem CID 2349260) has the molecular formula C17H16N2O3S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-phenylsulfanylpropanamide.
| Compound Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2349260 |
| Molecular Formula | C17H16N2O3S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-phenylsulfanylpropanamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)CCSc3ccccc3)sc2c1 |
| InChI | InChI=1S/C17H16N2O3S3/c1-25(21,22)13-7-8-14-15(11-13)24-17(18-14)19-16(20)9-10-23-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,18,19,20) |
| InChIKey | FTFVZMIZVOEGNZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |