C18H18N2O3S3 — CID 51958104
(2R)-2-benzylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 51958104) has the molecular formula C18H18N2O3S3 and a molecular weight of 406.55 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | (2R)-2-benzylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 51958104 |
| Molecular Formula | C18H18N2O3S3 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (2R)-2-benzylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)Nc1nc2ccc(S(C)(=O)=O)cc2s1 |
| InChI | InChI=1S/C18H18N2O3S3/c1-12(24-11-13-6-4-3-5-7-13)17(21)20-18-19-15-9-8-14(26(2,22)23)10-16(15)25-18/h3-10,12H,11H2,1-2H3,(H,19,20,21)/t12-/m1/s1 |
| InChIKey | KYOXORPPYXDMJD-GFCCVEGCSA-N |
| XLogP | 3.96 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |