C20H16F4N2O3 — CID 110586310
3-(4-fluorophenyl)-1-(2-methoxyethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione (PubChem CID 110586310) has the molecular formula C20H16F4N2O3 and a molecular weight of 408.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(2-methoxyethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1-(2-methoxyethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586310 |
| Molecular Formula | C20H16F4N2O3 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(2-methoxyethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C(Nc2cccc(C(F)(F)F)c2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H16F4N2O3/c1-29-10-9-26-18(27)16(12-5-7-14(21)8-6-12)17(19(26)28)25-15-4-2-3-13(11-15)20(22,23)24/h2-8,11,25H,9-10H2,1H3 |
| InChIKey | LXZYLOUQUGWNGN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|