C20H18Cl2N2O3 — CID 110598798
3-(2,4-dichlorophenyl)-1-methyl-4-(3-propoxyanilino)pyrrole-2,5-dione (PubChem CID 110598798) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methyl-4-(3-propoxyanilino)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(3-propoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598798 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(3-propoxyanilino)pyrrole-2,5-dione |
| SMILES | CCCOc1cccc(NC2=C(c3ccc(Cl)cc3Cl)C(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C20H18Cl2N2O3/c1-3-9-27-14-6-4-5-13(11-14)23-18-17(19(25)24(2)20(18)26)15-8-7-12(21)10-16(15)22/h4-8,10-11,23H,3,9H2,1-2H3 |
| InChIKey | GJUBIMFMIDMHFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|